About magnesium;1-fluoronaphthalene;dibromide
magnesium;1-fluoronaphthalene;dibromide (PubChem CID 174875222) has the molecular formula C10H7Br2FMg
and a molecular weight of 330.28 g/mol. Its IUPAC name is magnesium;1-fluoronaphthalene;dibromide.
Molecular Properties
| Compound Name | magnesium;1-fluoronaphthalene;dibromide |
|---|
| PubChem CID | 174875222 |
|---|
| Molecular Formula | C10H7Br2FMg |
|---|
| Molecular Weight | 330.28 g/mol |
|---|
| Exact Mass | 327.87 |
|---|
| IUPAC Name | magnesium;1-fluoronaphthalene;dibromide |
|---|
| SMILES | Fc1cccc2ccccc12.[Br-].[Br-].[Mg+2] |
|---|
| InChI | InChI=1S/C10H7F.2BrH.Mg/c11-10-7-3-5-8-4-1-2-6-9(8)10;;;/h1-7H;2*1H;/q;;;+2/p-2 |
|---|
| InChIKey | JEBXOYOAIKABBX-UHFFFAOYSA-L |
|---|
| XLogP | -3.39 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 14 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze magnesium;1-fluoronaphthalene;dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1-fluoronaphthalene;dibromide?
The IUPAC name of magnesium;1-fluoronaphthalene;dibromide (CID 174875222) is magnesium;1-fluoronaphthalene;dibromide.
What is the SMILES notation for magnesium;1-fluoronaphthalene;dibromide?
The canonical SMILES for magnesium;1-fluoronaphthalene;dibromide is Fc1cccc2ccccc12.[Br-].[Br-].[Mg+2].
What is the InChIKey of magnesium;1-fluoronaphthalene;dibromide?
The InChIKey is JEBXOYOAIKABBX-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H7F.2BrH.Mg/c11-10-7-3-5-8-4-1-2-6-9(8)10;;;/h1-7H;2*1H;/q;;;+2/p-2.
What are the key properties of magnesium;1-fluoronaphthalene;dibromide?
magnesium;1-fluoronaphthalene;dibromide has a molecular weight of 330.28 g/mol, XLogP of -3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1-fluoronaphthalene;dibromide is sourced from PubChem (CID 174875222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).