About azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid
azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid (PubChem CID 174875304) has the molecular formula C23H49NO3
and a molecular weight of 387.65 g/mol. Its IUPAC name is azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid.
Molecular Properties
| Compound Name | azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid |
| PubChem CID | 174875304 |
| Molecular Formula | C23H49NO3 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 387.37 |
| IUPAC Name | azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCC(CC(C)CCO)C(=O)O.N |
| InChI | InChI=1S/C23H46O3.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(23(25)26)20-21(2)18-19-24;/h21-22,24H,3-20H2,1-2H3,(H,25,26);1H3 |
| InChIKey | ZESYIFDJXLMKBH-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid?
The IUPAC name of azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid (CID 174875304) is azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid.
What is the SMILES notation for azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid?
The canonical SMILES for azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid is CCCCCCCCCCCCCCCCC(CC(C)CCO)C(=O)O.N.
What is the InChIKey of azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid?
The InChIKey is ZESYIFDJXLMKBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46O3.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(23(25)26)20-21(2)18-19-24;/h21-22,24H,3-20H2,1-2H3,(H,25,26);1H3.
What are the key properties of azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid?
azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid has a molecular weight of 387.65 g/mol, XLogP of 7.13, 20 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(4-hydroxy-2-methylbutyl)octadecanoic acid is sourced from PubChem (CID 174875304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).