About azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid
azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid (PubChem CID 174876443) has the molecular formula C9H22F3NO4S
and a molecular weight of 297.34 g/mol. Its IUPAC name is azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid |
| PubChem CID | 174876443 |
| Molecular Formula | C9H22F3NO4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid |
| SMILES | CCCCCC(C)(C)O.N.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C8H18O.CHF3O3S.H3N/c1-4-5-6-7-8(2,3)9;2-1(3,4)8(5,6)7;/h9H,4-7H2,1-3H3;(H,5,6,7);1H3 |
| InChIKey | IIHQRZNFGUULAO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid?
The IUPAC name of azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid (CID 174876443) is azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid.
What is the SMILES notation for azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid?
The canonical SMILES for azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid is CCCCCC(C)(C)O.N.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid?
The InChIKey is IIHQRZNFGUULAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.CHF3O3S.H3N/c1-4-5-6-7-8(2,3)9;2-1(3,4)8(5,6)7;/h9H,4-7H2,1-3H3;(H,5,6,7);1H3.
What are the key properties of azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid?
azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid has a molecular weight of 297.34 g/mol, XLogP of 2.89, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methylheptan-2-ol;trifluoromethanesulfonic acid is sourced from PubChem (CID 174876443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).