About 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline
2,3-di(cyclopenta-2,4-dien-1-yl)quinoline (PubChem CID 174876634) has the molecular formula C19H15N
and a molecular weight of 257.34 g/mol. Its IUPAC name is 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline.
Molecular Properties
| Compound Name | 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline |
| PubChem CID | 174876634 |
| Molecular Formula | C19H15N |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline |
| SMILES | C1=CC(c2cc3ccccc3nc2C2C=CC=C2)C=C1 |
| InChI | InChI=1S/C19H15N/c1-2-8-14(7-1)17-13-16-11-5-6-12-18(16)20-19(17)15-9-3-4-10-15/h1-15H |
| InChIKey | HEGKKJOFEBKXDN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline?
The IUPAC name of 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline (CID 174876634) is 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline.
What is the SMILES notation for 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline?
The canonical SMILES for 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline is C1=CC(c2cc3ccccc3nc2C2C=CC=C2)C=C1.
What is the InChIKey of 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline?
The InChIKey is HEGKKJOFEBKXDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N/c1-2-8-14(7-1)17-13-16-11-5-6-12-18(16)20-19(17)15-9-3-4-10-15/h1-15H.
What are the key properties of 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline?
2,3-di(cyclopenta-2,4-dien-1-yl)quinoline has a molecular weight of 257.34 g/mol, XLogP of 4.65, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(cyclopenta-2,4-dien-1-yl)quinoline is sourced from PubChem (CID 174876634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).