About 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole
3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole (PubChem CID 174876678) has the molecular formula C11H11F2NO
and a molecular weight of 211.21 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole |
| PubChem CID | 174876678 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole |
| SMILES | CC1(C)CC(c2cc(F)cc(F)c2)=NO1 |
| InChI | InChI=1S/C11H11F2NO/c1-11(2)6-10(14-15-11)7-3-8(12)5-9(13)4-7/h3-5H,6H2,1-2H3 |
| InChIKey | NRGHSGFTDNFWLH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole?
The IUPAC name of 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole (CID 174876678) is 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole.
What is the SMILES notation for 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole?
The canonical SMILES for 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole is CC1(C)CC(c2cc(F)cc(F)c2)=NO1.
What is the InChIKey of 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole?
The InChIKey is NRGHSGFTDNFWLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO/c1-11(2)6-10(14-15-11)7-3-8(12)5-9(13)4-7/h3-5H,6H2,1-2H3.
What are the key properties of 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole?
3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole has a molecular weight of 211.21 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluorophenyl)-5,5-dimethyl-4H-1,2-oxazole is sourced from PubChem (CID 174876678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).