C12H15BrO4 — CID 174876692
(2R,3R,4S)-4-(4-bromophenyl)-2-(1-hydroxyethyl)oxolane-3,4-diol (PubChem CID 174876692) has the molecular formula C12H15BrO4 and a molecular weight of 303.15 g/mol. Its IUPAC name is (2R,3R,4S)-4-(4-bromophenyl)-2-(1-hydroxyethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S)-4-(4-bromophenyl)-2-(1-hydroxyethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 174876692 |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | (2R,3R,4S)-4-(4-bromophenyl)-2-(1-hydroxyethyl)oxolane-3,4-diol |
| SMILES | CC(O)[C@H]1OC[C@@](O)(c2ccc(Br)cc2)[C@@H]1O |
| InChI | InChI=1S/C12H15BrO4/c1-7(14)10-11(15)12(16,6-17-10)8-2-4-9(13)5-3-8/h2-5,7,10-11,14-16H,6H2,1H3/t7?,10-,11-,12-/m1/s1 |
| InChIKey | OSXHRHOKDGBLLW-CUIDPCAOSA-N |
| XLogP | 0.78 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |