About 2,6-bis(fluoromethyl)pyridine;formamide
2,6-bis(fluoromethyl)pyridine;formamide (PubChem CID 174876959) has the molecular formula C8H10F2N2O
and a molecular weight of 188.18 g/mol. Its IUPAC name is 2,6-bis(fluoromethyl)pyridine;formamide.
Molecular Properties
| Compound Name | 2,6-bis(fluoromethyl)pyridine;formamide |
| PubChem CID | 174876959 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2,6-bis(fluoromethyl)pyridine;formamide |
| SMILES | FCc1cccc(CF)n1.NC=O |
| InChI | InChI=1S/C7H7F2N.CH3NO/c8-4-6-2-1-3-7(5-9)10-6;2-1-3/h1-3H,4-5H2;1H,(H2,2,3) |
| InChIKey | MKGFDORCPNYTQG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(fluoromethyl)pyridine;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(fluoromethyl)pyridine;formamide?
The IUPAC name of 2,6-bis(fluoromethyl)pyridine;formamide (CID 174876959) is 2,6-bis(fluoromethyl)pyridine;formamide.
What is the SMILES notation for 2,6-bis(fluoromethyl)pyridine;formamide?
The canonical SMILES for 2,6-bis(fluoromethyl)pyridine;formamide is FCc1cccc(CF)n1.NC=O.
What is the InChIKey of 2,6-bis(fluoromethyl)pyridine;formamide?
The InChIKey is MKGFDORCPNYTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F2N.CH3NO/c8-4-6-2-1-3-7(5-9)10-6;2-1-3/h1-3H,4-5H2;1H,(H2,2,3).
What are the key properties of 2,6-bis(fluoromethyl)pyridine;formamide?
2,6-bis(fluoromethyl)pyridine;formamide has a molecular weight of 188.18 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(fluoromethyl)pyridine;formamide is sourced from PubChem (CID 174876959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).