C20H34O — CID 174877315
[(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]methanol (PubChem CID 174877315) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]methanol.
| Compound Name | [(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]methanol |
|---|---|
| PubChem CID | 174877315 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | [(8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]methanol |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3CC(CO)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C20H34O/c1-19-9-3-4-17(19)16-6-5-15-12-14(13-21)7-11-20(15,2)18(16)8-10-19/h14-18,21H,3-13H2,1-2H3/t14?,15?,16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | YAMTXFWZEJWQJW-UKPFUUFUSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |