C24H37N5OS — CID 17487734
2-(morpholin-4-ylmethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 17487734) has the molecular formula C24H37N5OS and a molecular weight of 443.66 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(morpholin-4-ylmethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 17487734 |
| Molecular Formula | C24H37N5OS |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1(C)CC(Nc2nc(CN3CCOCC3)nc3sc4c(c23)CCCC4)CC(C)(C)N1 |
| InChI | InChI=1S/C24H37N5OS/c1-23(2)13-16(14-24(3,4)28-23)25-21-20-17-7-5-6-8-18(17)31-22(20)27-19(26-21)15-29-9-11-30-12-10-29/h16,28H,5-15H2,1-4H3,(H,25,26,27) |
| InChIKey | LOJKFCAYPVDLSY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |