C12H18N2O3 — CID 174878117
[2-(2-cyanoacetyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174878117) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is [2-(2-cyanoacetyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [2-(2-cyanoacetyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174878117 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | [2-(2-cyanoacetyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCCC1C(=O)CC#N |
| InChI | InChI=1S/C12H18N2O3/c1-12(2,3)11(16)17-14-8-4-5-9(14)10(15)6-7-13/h9H,4-6,8H2,1-3H3 |
| InChIKey | IWCLCRQAQFOMML-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |