About 1,2-dichlorobenzene;prop-2-enyl formate
1,2-dichlorobenzene;prop-2-enyl formate (PubChem CID 174878144) has the molecular formula C10H10Cl2O2
and a molecular weight of 233.09 g/mol. Its IUPAC name is 1,2-dichlorobenzene;prop-2-enyl formate.
Molecular Properties
| Compound Name | 1,2-dichlorobenzene;prop-2-enyl formate |
| PubChem CID | 174878144 |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 1,2-dichlorobenzene;prop-2-enyl formate |
| SMILES | C=CCOC=O.Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2.C4H6O2/c7-5-3-1-2-4-6(5)8;1-2-3-6-4-5/h1-4H;2,4H,1,3H2 |
| InChIKey | RHJSDLCQZKXJSZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichlorobenzene;prop-2-enyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorobenzene;prop-2-enyl formate?
The IUPAC name of 1,2-dichlorobenzene;prop-2-enyl formate (CID 174878144) is 1,2-dichlorobenzene;prop-2-enyl formate.
What is the SMILES notation for 1,2-dichlorobenzene;prop-2-enyl formate?
The canonical SMILES for 1,2-dichlorobenzene;prop-2-enyl formate is C=CCOC=O.Clc1ccccc1Cl.
What is the InChIKey of 1,2-dichlorobenzene;prop-2-enyl formate?
The InChIKey is RHJSDLCQZKXJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.C4H6O2/c7-5-3-1-2-4-6(5)8;1-2-3-6-4-5/h1-4H;2,4H,1,3H2.
What are the key properties of 1,2-dichlorobenzene;prop-2-enyl formate?
1,2-dichlorobenzene;prop-2-enyl formate has a molecular weight of 233.09 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorobenzene;prop-2-enyl formate is sourced from PubChem (CID 174878144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).