About bis(4-phenyl-1,3-oxazolidin-2-yl)methanone
bis(4-phenyl-1,3-oxazolidin-2-yl)methanone (PubChem CID 174878189) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is bis(4-phenyl-1,3-oxazolidin-2-yl)methanone.
Molecular Properties
| Compound Name | bis(4-phenyl-1,3-oxazolidin-2-yl)methanone |
| PubChem CID | 174878189 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | bis(4-phenyl-1,3-oxazolidin-2-yl)methanone |
| SMILES | O=C(C1NC(c2ccccc2)CO1)C1NC(c2ccccc2)CO1 |
| InChI | InChI=1S/C19H20N2O3/c22-17(18-20-15(11-23-18)13-7-3-1-4-8-13)19-21-16(12-24-19)14-9-5-2-6-10-14/h1-10,15-16,18-21H,11-12H2 |
| InChIKey | BMQKVXGMCPPFHH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(4-phenyl-1,3-oxazolidin-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-phenyl-1,3-oxazolidin-2-yl)methanone?
The IUPAC name of bis(4-phenyl-1,3-oxazolidin-2-yl)methanone (CID 174878189) is bis(4-phenyl-1,3-oxazolidin-2-yl)methanone.
What is the SMILES notation for bis(4-phenyl-1,3-oxazolidin-2-yl)methanone?
The canonical SMILES for bis(4-phenyl-1,3-oxazolidin-2-yl)methanone is O=C(C1NC(c2ccccc2)CO1)C1NC(c2ccccc2)CO1.
What is the InChIKey of bis(4-phenyl-1,3-oxazolidin-2-yl)methanone?
The InChIKey is BMQKVXGMCPPFHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c22-17(18-20-15(11-23-18)13-7-3-1-4-8-13)19-21-16(12-24-19)14-9-5-2-6-10-14/h1-10,15-16,18-21H,11-12H2.
What are the key properties of bis(4-phenyl-1,3-oxazolidin-2-yl)methanone?
bis(4-phenyl-1,3-oxazolidin-2-yl)methanone has a molecular weight of 324.38 g/mol, XLogP of 1.93, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-phenyl-1,3-oxazolidin-2-yl)methanone is sourced from PubChem (CID 174878189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).