C12H17NO4S — CID 174878483
4-phenylmethoxypiperidine-1-sulfonic acid (PubChem CID 174878483) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-phenylmethoxypiperidine-1-sulfonic acid.
| Compound Name | 4-phenylmethoxypiperidine-1-sulfonic acid |
|---|---|
| PubChem CID | 174878483 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4-phenylmethoxypiperidine-1-sulfonic acid |
| SMILES | O=S(=O)(O)N1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C12H17NO4S/c14-18(15,16)13-8-6-12(7-9-13)17-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,14,15,16) |
| InChIKey | SBMVJSIMVQQVFK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|