About N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide
N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide (PubChem CID 174878508) has the molecular formula C13H12F2N4O2S
and a molecular weight of 326.33 g/mol. Its IUPAC name is N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide |
| PubChem CID | 174878508 |
| Molecular Formula | C13H12F2N4O2S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide |
| SMILES | O=S(=O)(Nc1nccnc1Nc1ccc(F)c(F)c1)C1CC1 |
| InChI | InChI=1S/C13H12F2N4O2S/c14-10-4-1-8(7-11(10)15)18-12-13(17-6-5-16-12)19-22(20,21)9-2-3-9/h1,4-7,9H,2-3H2,(H,16,18)(H,17,19) |
| InChIKey | HLQFEXXRKDQWSA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide?
The IUPAC name of N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide (CID 174878508) is N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide.
What is the SMILES notation for N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide?
The canonical SMILES for N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide is O=S(=O)(Nc1nccnc1Nc1ccc(F)c(F)c1)C1CC1.
What is the InChIKey of N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide?
The InChIKey is HLQFEXXRKDQWSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N4O2S/c14-10-4-1-8(7-11(10)15)18-12-13(17-6-5-16-12)19-22(20,21)9-2-3-9/h1,4-7,9H,2-3H2,(H,16,18)(H,17,19).
What are the key properties of N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide?
N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide has a molecular weight of 326.33 g/mol, XLogP of 2.40, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,4-difluoroanilino)pyrazin-2-yl]cyclopropanesulfonamide is sourced from PubChem (CID 174878508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).