2-oxoethyl N-ethyl-N-methylcarbamate

C6H11NO3 — CID 174878771

IUPAC2-oxoethyl N-ethyl-N-methylcarbamate
SMILESCCN(C)C(=O)OCC=O
InChIInChI=1S/C6H11NO3/c1-3-7(2)6(9)10-5-4-8/h4H,3,5H2,1-2H3
InChIKeyGNJOTNXANGHJDV-UHFFFAOYSA-N
MW145.16 g/mol
LogP0.27
Rot. Bonds3

About 2-oxoethyl N-ethyl-N-methylcarbamate

2-oxoethyl N-ethyl-N-methylcarbamate (PubChem CID 174878771) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-oxoethyl N-ethyl-N-methylcarbamate.

Molecular Properties

Compound Name2-oxoethyl N-ethyl-N-methylcarbamate
PubChem CID174878771
Molecular FormulaC6H11NO3
Molecular Weight145.16 g/mol
Exact Mass145.07
IUPAC Name2-oxoethyl N-ethyl-N-methylcarbamate
SMILESCCN(C)C(=O)OCC=O
InChIInChI=1S/C6H11NO3/c1-3-7(2)6(9)10-5-4-8/h4H,3,5H2,1-2H3
InChIKeyGNJOTNXANGHJDV-UHFFFAOYSA-N
XLogP0.27
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.16
LogP ≤ 50.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-oxoethyl N-ethyl-N-methylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxoethyl N-ethyl-N-methylcarbamate?
The IUPAC name of 2-oxoethyl N-ethyl-N-methylcarbamate (CID 174878771) is 2-oxoethyl N-ethyl-N-methylcarbamate.
What is the SMILES notation for 2-oxoethyl N-ethyl-N-methylcarbamate?
The canonical SMILES for 2-oxoethyl N-ethyl-N-methylcarbamate is CCN(C)C(=O)OCC=O.
What is the InChIKey of 2-oxoethyl N-ethyl-N-methylcarbamate?
The InChIKey is GNJOTNXANGHJDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-3-7(2)6(9)10-5-4-8/h4H,3,5H2,1-2H3.
What are the key properties of 2-oxoethyl N-ethyl-N-methylcarbamate?
2-oxoethyl N-ethyl-N-methylcarbamate has a molecular weight of 145.16 g/mol, XLogP of 0.27, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoethyl N-ethyl-N-methylcarbamate is sourced from PubChem (CID 174878771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).