About (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine
(3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine (PubChem CID 174879610) has the molecular formula C24H37N3
and a molecular weight of 367.58 g/mol. Its IUPAC name is (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine.
Molecular Properties
| Compound Name | (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine |
| PubChem CID | 174879610 |
| Molecular Formula | C24H37N3 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.30 |
| IUPAC Name | (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine |
| SMILES | CCCCCN[C@@H]1CCN(CC(C)C)C1.c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C13H28N2.C11H9N/c1-4-5-6-8-14-13-7-9-15(11-13)10-12(2)3;1-2-5-10(6-3-1)11-7-4-8-12-9-11/h12-14H,4-11H2,1-3H3;1-9H/t13-;/m1./s1 |
| InChIKey | NYBQMJUOBZQYOS-BTQNPOSSSA-N |
| XLogP | 5.25 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine?
The IUPAC name of (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine (CID 174879610) is (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine.
What is the SMILES notation for (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine?
The canonical SMILES for (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine is CCCCCN[C@@H]1CCN(CC(C)C)C1.c1ccc(-c2cccnc2)cc1.
What is the InChIKey of (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine?
The InChIKey is NYBQMJUOBZQYOS-BTQNPOSSSA-N. The full InChI is InChI=1S/C13H28N2.C11H9N/c1-4-5-6-8-14-13-7-9-15(11-13)10-12(2)3;1-2-5-10(6-3-1)11-7-4-8-12-9-11/h12-14H,4-11H2,1-3H3;1-9H/t13-;/m1./s1.
What are the key properties of (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine?
(3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine has a molecular weight of 367.58 g/mol, XLogP of 5.25, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2-methylpropyl)-N-pentylpyrrolidin-3-amine;3-phenylpyridine is sourced from PubChem (CID 174879610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).