C19H27N — CID 174880819
1,1,2,2,3,4-hexamethyl-4,6-dihydro-3H-benzo[a]quinolizine (PubChem CID 174880819) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 1,1,2,2,3,4-hexamethyl-4,6-dihydro-3H-benzo[a]quinolizine.
| Compound Name | 1,1,2,2,3,4-hexamethyl-4,6-dihydro-3H-benzo[a]quinolizine |
|---|---|
| PubChem CID | 174880819 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 1,1,2,2,3,4-hexamethyl-4,6-dihydro-3H-benzo[a]quinolizine |
| SMILES | CC1C(C)C(C)(C)C(C)(C)C2=c3ccccc3=CCN21 |
| InChI | InChI=1S/C19H27N/c1-13-14(2)20-12-11-15-9-7-8-10-16(15)17(20)19(5,6)18(13,3)4/h7-11,13-14H,12H2,1-6H3 |
| InChIKey | UQGIIMLXYDHQRF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |