About zinc 5-nitrosobenzene-1,3-dicarboxylate
zinc 5-nitrosobenzene-1,3-dicarboxylate (PubChem CID 174881003) has the molecular formula C8H3NO5Zn
and a molecular weight of 258.50 g/mol. Its IUPAC name is zinc 5-nitrosobenzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | zinc 5-nitrosobenzene-1,3-dicarboxylate |
| PubChem CID | 174881003 |
| Molecular Formula | C8H3NO5Zn |
| Molecular Weight | 258.50 g/mol |
| Exact Mass | 256.93 |
| IUPAC Name | zinc 5-nitrosobenzene-1,3-dicarboxylate |
| SMILES | O=Nc1cc(C(=O)[O-])cc(C(=O)[O-])c1.[Zn+2] |
| InChI | InChI=1S/C8H5NO5.Zn/c10-7(11)4-1-5(8(12)13)3-6(2-4)9-14;/h1-3H,(H,10,11)(H,12,13);/q;+2/p-2 |
| InChIKey | QIDBBYIJASPJKX-UHFFFAOYSA-L |
| XLogP | -1.19 |
| TPSA | 109.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.50 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc 5-nitrosobenzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc 5-nitrosobenzene-1,3-dicarboxylate?
The IUPAC name of zinc 5-nitrosobenzene-1,3-dicarboxylate (CID 174881003) is zinc 5-nitrosobenzene-1,3-dicarboxylate.
What is the SMILES notation for zinc 5-nitrosobenzene-1,3-dicarboxylate?
The canonical SMILES for zinc 5-nitrosobenzene-1,3-dicarboxylate is O=Nc1cc(C(=O)[O-])cc(C(=O)[O-])c1.[Zn+2].
What is the InChIKey of zinc 5-nitrosobenzene-1,3-dicarboxylate?
The InChIKey is QIDBBYIJASPJKX-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H5NO5.Zn/c10-7(11)4-1-5(8(12)13)3-6(2-4)9-14;/h1-3H,(H,10,11)(H,12,13);/q;+2/p-2.
What are the key properties of zinc 5-nitrosobenzene-1,3-dicarboxylate?
zinc 5-nitrosobenzene-1,3-dicarboxylate has a molecular weight of 258.50 g/mol, XLogP of -1.19, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc 5-nitrosobenzene-1,3-dicarboxylate is sourced from PubChem (CID 174881003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).