About 3-(1-ethoxyethenyl)-1,2,4-thiadiazole
3-(1-ethoxyethenyl)-1,2,4-thiadiazole (PubChem CID 174881034) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is 3-(1-ethoxyethenyl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-(1-ethoxyethenyl)-1,2,4-thiadiazole |
| PubChem CID | 174881034 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 3-(1-ethoxyethenyl)-1,2,4-thiadiazole |
| SMILES | C=C(OCC)c1ncsn1 |
| InChI | InChI=1S/C6H8N2OS/c1-3-9-5(2)6-7-4-10-8-6/h4H,2-3H2,1H3 |
| InChIKey | CJKJOHYDBLQAOI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-ethoxyethenyl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethoxyethenyl)-1,2,4-thiadiazole?
The IUPAC name of 3-(1-ethoxyethenyl)-1,2,4-thiadiazole (CID 174881034) is 3-(1-ethoxyethenyl)-1,2,4-thiadiazole.
What is the SMILES notation for 3-(1-ethoxyethenyl)-1,2,4-thiadiazole?
The canonical SMILES for 3-(1-ethoxyethenyl)-1,2,4-thiadiazole is C=C(OCC)c1ncsn1.
What is the InChIKey of 3-(1-ethoxyethenyl)-1,2,4-thiadiazole?
The InChIKey is CJKJOHYDBLQAOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c1-3-9-5(2)6-7-4-10-8-6/h4H,2-3H2,1H3.
What are the key properties of 3-(1-ethoxyethenyl)-1,2,4-thiadiazole?
3-(1-ethoxyethenyl)-1,2,4-thiadiazole has a molecular weight of 156.21 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethoxyethenyl)-1,2,4-thiadiazole is sourced from PubChem (CID 174881034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).