About 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene
1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene (PubChem CID 174881446) has the molecular formula C11H12BrIN2O2
and a molecular weight of 411.04 g/mol. Its IUPAC name is 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene.
Molecular Properties
| Compound Name | 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene |
| PubChem CID | 174881446 |
| Molecular Formula | C11H12BrIN2O2 |
| Molecular Weight | 411.04 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene |
| SMILES | CC1(C)C(=O)NC(=O)N1Br.Ic1ccccc1 |
| InChI | InChI=1S/C6H5I.C5H7BrN2O2/c7-6-4-2-1-3-5-6;1-5(2)3(9)7-4(10)8(5)6/h1-5H;1-2H3,(H,7,9,10) |
| InChIKey | VCDZERPRVXOBOW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.04 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene?
The IUPAC name of 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene (CID 174881446) is 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene.
What is the SMILES notation for 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene?
The canonical SMILES for 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene is CC1(C)C(=O)NC(=O)N1Br.Ic1ccccc1.
What is the InChIKey of 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene?
The InChIKey is VCDZERPRVXOBOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5I.C5H7BrN2O2/c7-6-4-2-1-3-5-6;1-5(2)3(9)7-4(10)8(5)6/h1-5H;1-2H3,(H,7,9,10).
What are the key properties of 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene?
1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene has a molecular weight of 411.04 g/mol, XLogP of 2.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene is sourced from PubChem (CID 174881446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).