About azane;1,1-diazidocyclopropane
azane;1,1-diazidocyclopropane (PubChem CID 174882116) has the molecular formula C3H7N7
and a molecular weight of 141.14 g/mol. Its IUPAC name is azane;1,1-diazidocyclopropane.
Molecular Properties
| Compound Name | azane;1,1-diazidocyclopropane |
| PubChem CID | 174882116 |
| Molecular Formula | C3H7N7 |
| Molecular Weight | 141.14 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | azane;1,1-diazidocyclopropane |
| SMILES | N.[N-]=[N+]=NC1(N=[N+]=[N-])CC1 |
| InChI | InChI=1S/C3H4N6.H3N/c4-8-6-3(1-2-3)7-9-5;/h1-2H2;1H3 |
| InChIKey | IYBRCHITTBGBJJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azane;1,1-diazidocyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,1-diazidocyclopropane?
The IUPAC name of azane;1,1-diazidocyclopropane (CID 174882116) is azane;1,1-diazidocyclopropane.
What is the SMILES notation for azane;1,1-diazidocyclopropane?
The canonical SMILES for azane;1,1-diazidocyclopropane is N.[N-]=[N+]=NC1(N=[N+]=[N-])CC1.
What is the InChIKey of azane;1,1-diazidocyclopropane?
The InChIKey is IYBRCHITTBGBJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N6.H3N/c4-8-6-3(1-2-3)7-9-5;/h1-2H2;1H3.
What are the key properties of azane;1,1-diazidocyclopropane?
azane;1,1-diazidocyclopropane has a molecular weight of 141.14 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,1-diazidocyclopropane is sourced from PubChem (CID 174882116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).