About 2,2-dibutylpyrrole
2,2-dibutylpyrrole (PubChem CID 174882814) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 2,2-dibutylpyrrole.
Molecular Properties
| Compound Name | 2,2-dibutylpyrrole |
| PubChem CID | 174882814 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2,2-dibutylpyrrole |
| SMILES | CCCCC1(CCCC)C=CC=N1 |
| InChI | InChI=1S/C12H21N/c1-3-5-8-12(9-6-4-2)10-7-11-13-12/h7,10-11H,3-6,8-9H2,1-2H3 |
| InChIKey | UZSJXCIHZGWCKR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dibutylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibutylpyrrole?
The IUPAC name of 2,2-dibutylpyrrole (CID 174882814) is 2,2-dibutylpyrrole.
What is the SMILES notation for 2,2-dibutylpyrrole?
The canonical SMILES for 2,2-dibutylpyrrole is CCCCC1(CCCC)C=CC=N1.
What is the InChIKey of 2,2-dibutylpyrrole?
The InChIKey is UZSJXCIHZGWCKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-3-5-8-12(9-6-4-2)10-7-11-13-12/h7,10-11H,3-6,8-9H2,1-2H3.
What are the key properties of 2,2-dibutylpyrrole?
2,2-dibutylpyrrole has a molecular weight of 179.31 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibutylpyrrole is sourced from PubChem (CID 174882814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).