About 2-methylheptadec-2-enoic acid;hydrofluoride
2-methylheptadec-2-enoic acid;hydrofluoride (PubChem CID 174883773) has the molecular formula C18H35FO2
and a molecular weight of 302.47 g/mol. Its IUPAC name is 2-methylheptadec-2-enoic acid;hydrofluoride.
Molecular Properties
| Compound Name | 2-methylheptadec-2-enoic acid;hydrofluoride |
| PubChem CID | 174883773 |
| Molecular Formula | C18H35FO2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 2-methylheptadec-2-enoic acid;hydrofluoride |
| SMILES | CCCCCCCCCCCCCCC=C(C)C(=O)O.F |
| InChI | InChI=1S/C18H34O2.FH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18(19)20;/h16H,3-15H2,1-2H3,(H,19,20);1H |
| InChIKey | HNXDKJLNRXNVHA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylheptadec-2-enoic acid;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylheptadec-2-enoic acid;hydrofluoride?
The IUPAC name of 2-methylheptadec-2-enoic acid;hydrofluoride (CID 174883773) is 2-methylheptadec-2-enoic acid;hydrofluoride.
What is the SMILES notation for 2-methylheptadec-2-enoic acid;hydrofluoride?
The canonical SMILES for 2-methylheptadec-2-enoic acid;hydrofluoride is CCCCCCCCCCCCCCC=C(C)C(=O)O.F.
What is the InChIKey of 2-methylheptadec-2-enoic acid;hydrofluoride?
The InChIKey is HNXDKJLNRXNVHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2.FH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18(19)20;/h16H,3-15H2,1-2H3,(H,19,20);1H.
What are the key properties of 2-methylheptadec-2-enoic acid;hydrofluoride?
2-methylheptadec-2-enoic acid;hydrofluoride has a molecular weight of 302.47 g/mol, XLogP of 6.26, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylheptadec-2-enoic acid;hydrofluoride is sourced from PubChem (CID 174883773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).