C19H33Br3O10 — CID 174884108
6-O-bromo 1-O-ethyl hexanedioate;dimethyl 2,6-dibromoheptanedioate;ethane-1,2-diol (PubChem CID 174884108) has the molecular formula C19H33Br3O10 and a molecular weight of 661.17 g/mol. Its IUPAC name is 6-O-bromo 1-O-ethyl hexanedioate;dimethyl 2,6-dibromoheptanedioate;ethane-1,2-diol.
| Compound Name | 6-O-bromo 1-O-ethyl hexanedioate;dimethyl 2,6-dibromoheptanedioate;ethane-1,2-diol |
|---|---|
| PubChem CID | 174884108 |
| Molecular Formula | C19H33Br3O10 |
| Molecular Weight | 661.17 g/mol |
| Exact Mass | 657.96 |
| IUPAC Name | 6-O-bromo 1-O-ethyl hexanedioate;dimethyl 2,6-dibromoheptanedioate;ethane-1,2-diol |
| SMILES | CCOC(=O)CCCCC(=O)OBr.COC(=O)C(Br)CCCC(Br)C(=O)OC.OCCO |
| InChI | InChI=1S/C9H14Br2O4.C8H13BrO4.C2H6O2/c1-14-8(12)6(10)4-3-5-7(11)9(13)15-2;1-2-12-7(10)5-3-4-6-8(11)13-9;3-1-2-4/h6-7H,3-5H2,1-2H3;2-6H2,1H3;3-4H,1-2H2 |
| InChIKey | ADURJNCRTXKHGI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.17 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|