About nitramide;piperazine
nitramide;piperazine (PubChem CID 174884575) has the molecular formula C8H22N6O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is nitramide;piperazine.
Molecular Properties
| Compound Name | nitramide;piperazine |
| PubChem CID | 174884575 |
| Molecular Formula | C8H22N6O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | nitramide;piperazine |
| SMILES | C1CNCCN1.C1CNCCN1.N[N+](=O)[O-] |
| InChI | InChI=1S/2C4H10N2.H2N2O2/c2*1-2-6-4-3-5-1;1-2(3)4/h2*5-6H,1-4H2;1H2 |
| InChIKey | OMBMIKPDQNSVGO-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitramide;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitramide;piperazine?
The IUPAC name of nitramide;piperazine (CID 174884575) is nitramide;piperazine.
What is the SMILES notation for nitramide;piperazine?
The canonical SMILES for nitramide;piperazine is C1CNCCN1.C1CNCCN1.N[N+](=O)[O-].
What is the InChIKey of nitramide;piperazine?
The InChIKey is OMBMIKPDQNSVGO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H10N2.H2N2O2/c2*1-2-6-4-3-5-1;1-2(3)4/h2*5-6H,1-4H2;1H2.
What are the key properties of nitramide;piperazine?
nitramide;piperazine has a molecular weight of 234.30 g/mol, XLogP of -2.50, 0 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nitramide;piperazine is sourced from PubChem (CID 174884575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).