About [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate
[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate (PubChem CID 174884796) has the molecular formula C5H6NO8P
and a molecular weight of 239.08 g/mol. Its IUPAC name is [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate.
Molecular Properties
| Compound Name | [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate |
| PubChem CID | 174884796 |
| Molecular Formula | C5H6NO8P |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate |
| SMILES | O=C(O)OP(=O)(O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C5H6NO8P/c7-3-1-2-4(8)6(3)14-15(11,12)13-5(9)10/h1-2H2,(H,9,10)(H,11,12) |
| InChIKey | NNPMKEBJHALKCL-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate?
The IUPAC name of [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate (CID 174884796) is [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate.
What is the SMILES notation for [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate?
The canonical SMILES for [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate is O=C(O)OP(=O)(O)ON1C(=O)CCC1=O.
What is the InChIKey of [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate?
The InChIKey is NNPMKEBJHALKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6NO8P/c7-3-1-2-4(8)6(3)14-15(11,12)13-5(9)10/h1-2H2,(H,9,10)(H,11,12).
What are the key properties of [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate?
[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate has a molecular weight of 239.08 g/mol, XLogP of -0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,5-dioxopyrrolidin-1-yl)oxy-hydroxyphosphoryl] hydrogen carbonate is sourced from PubChem (CID 174884796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).