About dichloromethane;3,5-dichloropentan-2-one
dichloromethane;3,5-dichloropentan-2-one (PubChem CID 174884835) has the molecular formula C6H10Cl4O
and a molecular weight of 239.96 g/mol. Its IUPAC name is dichloromethane;3,5-dichloropentan-2-one.
Molecular Properties
| Compound Name | dichloromethane;3,5-dichloropentan-2-one |
| PubChem CID | 174884835 |
| Molecular Formula | C6H10Cl4O |
| Molecular Weight | 239.96 g/mol |
| Exact Mass | 237.95 |
| IUPAC Name | dichloromethane;3,5-dichloropentan-2-one |
| SMILES | CC(=O)C(Cl)CCCl.ClCCl |
| InChI | InChI=1S/C5H8Cl2O.CH2Cl2/c1-4(8)5(7)2-3-6;2-1-3/h5H,2-3H2,1H3;1H2 |
| InChIKey | WZZDNEAMFOGTOC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.96 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;3,5-dichloropentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;3,5-dichloropentan-2-one?
The IUPAC name of dichloromethane;3,5-dichloropentan-2-one (CID 174884835) is dichloromethane;3,5-dichloropentan-2-one.
What is the SMILES notation for dichloromethane;3,5-dichloropentan-2-one?
The canonical SMILES for dichloromethane;3,5-dichloropentan-2-one is CC(=O)C(Cl)CCCl.ClCCl.
What is the InChIKey of dichloromethane;3,5-dichloropentan-2-one?
The InChIKey is WZZDNEAMFOGTOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8Cl2O.CH2Cl2/c1-4(8)5(7)2-3-6;2-1-3/h5H,2-3H2,1H3;1H2.
What are the key properties of dichloromethane;3,5-dichloropentan-2-one?
dichloromethane;3,5-dichloropentan-2-one has a molecular weight of 239.96 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;3,5-dichloropentan-2-one is sourced from PubChem (CID 174884835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).