C7H7F3O2S — CID 174884928
5-methyl-3-(2,2,2-trifluoroethyl)thiolane-2,4-dione (PubChem CID 174884928) has the molecular formula C7H7F3O2S and a molecular weight of 212.19 g/mol. Its IUPAC name is 5-methyl-3-(2,2,2-trifluoroethyl)thiolane-2,4-dione.
| Compound Name | 5-methyl-3-(2,2,2-trifluoroethyl)thiolane-2,4-dione |
|---|---|
| PubChem CID | 174884928 |
| Molecular Formula | C7H7F3O2S |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 5-methyl-3-(2,2,2-trifluoroethyl)thiolane-2,4-dione |
| SMILES | CC1SC(=O)C(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C7H7F3O2S/c1-3-5(11)4(6(12)13-3)2-7(8,9)10/h3-4H,2H2,1H3 |
| InChIKey | NIFBQTYQZLHXQR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|