C22H28N7O5P — CID 174885095
2-[[[(4R)-3-[4-[2-(dicyanomethylidene)hydrazinyl]phenyl]-4-methyl-6-oxo-4,5-dihydropyridazin-1-yl]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid (PubChem CID 174885095) has the molecular formula C22H28N7O5P and a molecular weight of 501.48 g/mol. Its IUPAC name is 2-[[[(4R)-3-[4-[2-(dicyanomethylidene)hydrazinyl]phenyl]-4-methyl-6-oxo-4,5-dihydropyridazin-1-yl]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid.
| Compound Name | 2-[[[(4R)-3-[4-[2-(dicyanomethylidene)hydrazinyl]phenyl]-4-methyl-6-oxo-4,5-dihydropyridazin-1-yl]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 174885095 |
| Molecular Formula | C22H28N7O5P |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 2-[[[(4R)-3-[4-[2-(dicyanomethylidene)hydrazinyl]phenyl]-4-methyl-6-oxo-4,5-dihydropyridazin-1-yl]-(methoxymethyl)phosphoryl]amino]-2,3-dimethylbutanoic acid |
| SMILES | COCP(=O)(NC(C)(C(=O)O)C(C)C)N1N=C(c2ccc(NN=C(C#N)C#N)cc2)[C@H](C)CC1=O |
| InChI | InChI=1S/C22H28N7O5P/c1-14(2)22(4,21(31)32)28-35(33,13-34-5)29-19(30)10-15(3)20(27-29)16-6-8-17(9-7-16)25-26-18(11-23)12-24/h6-9,14-15,25H,10,13H2,1-5H3,(H,28,33)(H,31,32)/t15-,22?,35?/m1/s1 |
| InChIKey | LWVUZHJHFJSFPO-LDBNOBEISA-N |
| XLogP | 2.96 |
| TPSA | 180.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|