About 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate
2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate (PubChem CID 174885519) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate.
Molecular Properties
| Compound Name | 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate |
| PubChem CID | 174885519 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate |
| SMILES | C=C(C)C#N.C=C(C)C(=O)OCC1CO1.O |
| InChI | InChI=1S/C7H10O3.C4H5N.H2O/c1-5(2)7(8)10-4-6-3-9-6;1-4(2)3-5;/h6H,1,3-4H2,2H3;1H2,2H3;1H2 |
| InChIKey | YOXQTFBFQCBESD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate?
The IUPAC name of 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate (CID 174885519) is 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate.
What is the SMILES notation for 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate?
The canonical SMILES for 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate is C=C(C)C#N.C=C(C)C(=O)OCC1CO1.O.
What is the InChIKey of 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate?
The InChIKey is YOXQTFBFQCBESD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.C4H5N.H2O/c1-5(2)7(8)10-4-6-3-9-6;1-4(2)3-5;/h6H,1,3-4H2,2H3;1H2,2H3;1H2.
What are the key properties of 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate?
2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate has a molecular weight of 227.26 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enenitrile;oxiran-2-ylmethyl 2-methylprop-2-enoate;hydrate is sourced from PubChem (CID 174885519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).