C10H14F5NO3S — CID 174885538
1-ethyl-3-methyl-2H-pyridine;1,1,2,2,2-pentafluoroethanesulfonic acid (PubChem CID 174885538) has the molecular formula C10H14F5NO3S and a molecular weight of 323.28 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2H-pyridine;1,1,2,2,2-pentafluoroethanesulfonic acid.
| Compound Name | 1-ethyl-3-methyl-2H-pyridine;1,1,2,2,2-pentafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 174885538 |
| Molecular Formula | C10H14F5NO3S |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-ethyl-3-methyl-2H-pyridine;1,1,2,2,2-pentafluoroethanesulfonic acid |
| SMILES | CCN1C=CC=C(C)C1.O=S(=O)(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H13N.C2HF5O3S/c1-3-9-6-4-5-8(2)7-9;3-1(4,5)2(6,7)11(8,9)10/h4-6H,3,7H2,1-2H3;(H,8,9,10) |
| InChIKey | IYMYZYSOELUOCI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|