About diphenylphosphane;thiolane
diphenylphosphane;thiolane (PubChem CID 174886019) has the molecular formula C16H19PS
and a molecular weight of 274.37 g/mol. Its IUPAC name is diphenylphosphane;thiolane.
Molecular Properties
| Compound Name | diphenylphosphane;thiolane |
| PubChem CID | 174886019 |
| Molecular Formula | C16H19PS |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | diphenylphosphane;thiolane |
| SMILES | C1CCSC1.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C4H8S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-5-3-1/h1-10,13H;1-4H2 |
| InChIKey | PTGNGCUVGFCQPA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;thiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;thiolane?
The IUPAC name of diphenylphosphane;thiolane (CID 174886019) is diphenylphosphane;thiolane.
What is the SMILES notation for diphenylphosphane;thiolane?
The canonical SMILES for diphenylphosphane;thiolane is C1CCSC1.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;thiolane?
The InChIKey is PTGNGCUVGFCQPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.C4H8S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-5-3-1/h1-10,13H;1-4H2.
What are the key properties of diphenylphosphane;thiolane?
diphenylphosphane;thiolane has a molecular weight of 274.37 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;thiolane is sourced from PubChem (CID 174886019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).