About [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate
[3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate (PubChem CID 174887097) has the molecular formula C23H38N2O2
and a molecular weight of 374.57 g/mol. Its IUPAC name is [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate.
Molecular Properties
| Compound Name | [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate |
| PubChem CID | 174887097 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)Oc1ccc(N(CCC(C)C)C2CCCCC2)c(N)c1 |
| InChI | InChI=1S/C23H38N2O2/c1-5-9-18(4)23(26)27-20-12-13-22(21(24)16-20)25(15-14-17(2)3)19-10-7-6-8-11-19/h12-13,16-19H,5-11,14-15,24H2,1-4H3 |
| InChIKey | STBVBYHKONBIAX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate?
The IUPAC name of [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate (CID 174887097) is [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate.
What is the SMILES notation for [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate?
The canonical SMILES for [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate is CCCC(C)C(=O)Oc1ccc(N(CCC(C)C)C2CCCCC2)c(N)c1.
What is the InChIKey of [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate?
The InChIKey is STBVBYHKONBIAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H38N2O2/c1-5-9-18(4)23(26)27-20-12-13-22(21(24)16-20)25(15-14-17(2)3)19-10-7-6-8-11-19/h12-13,16-19H,5-11,14-15,24H2,1-4H3.
What are the key properties of [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate?
[3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate has a molecular weight of 374.57 g/mol, XLogP of 5.80, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-4-[cyclohexyl(3-methylbutyl)amino]phenyl] 2-methylpentanoate is sourced from PubChem (CID 174887097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).