C7H8F6N2O3S — CID 174887908
1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid;2-methyl-1H-imidazole (PubChem CID 174887908) has the molecular formula C7H8F6N2O3S and a molecular weight of 314.21 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid;2-methyl-1H-imidazole.
| Compound Name | 1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid;2-methyl-1H-imidazole |
|---|---|
| PubChem CID | 174887908 |
| Molecular Formula | C7H8F6N2O3S |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid;2-methyl-1H-imidazole |
| SMILES | Cc1ncc[nH]1.O=S(=O)(O)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C4H6N2.C3H2F6O3S/c1-4-5-2-3-6-4;4-1(5)2(6,7)3(8,9)13(10,11)12/h2-3H,1H3,(H,5,6);1H,(H,10,11,12) |
| InChIKey | VCFXNXYGZVOAHD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|