About 1-bromo-1-(3-methylphenyl)urea;pyrimidine
1-bromo-1-(3-methylphenyl)urea;pyrimidine (PubChem CID 174887918) has the molecular formula C12H13BrN4O
and a molecular weight of 309.17 g/mol. Its IUPAC name is 1-bromo-1-(3-methylphenyl)urea;pyrimidine.
Molecular Properties
| Compound Name | 1-bromo-1-(3-methylphenyl)urea;pyrimidine |
| PubChem CID | 174887918 |
| Molecular Formula | C12H13BrN4O |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 1-bromo-1-(3-methylphenyl)urea;pyrimidine |
| SMILES | Cc1cccc(N(Br)C(N)=O)c1.c1cncnc1 |
| InChI | InChI=1S/C8H9BrN2O.C4H4N2/c1-6-3-2-4-7(5-6)11(9)8(10)12;1-2-5-4-6-3-1/h2-5H,1H3,(H2,10,12);1-4H |
| InChIKey | DDCHGAKMUVSZNW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-1-(3-methylphenyl)urea;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-1-(3-methylphenyl)urea;pyrimidine?
The IUPAC name of 1-bromo-1-(3-methylphenyl)urea;pyrimidine (CID 174887918) is 1-bromo-1-(3-methylphenyl)urea;pyrimidine.
What is the SMILES notation for 1-bromo-1-(3-methylphenyl)urea;pyrimidine?
The canonical SMILES for 1-bromo-1-(3-methylphenyl)urea;pyrimidine is Cc1cccc(N(Br)C(N)=O)c1.c1cncnc1.
What is the InChIKey of 1-bromo-1-(3-methylphenyl)urea;pyrimidine?
The InChIKey is DDCHGAKMUVSZNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2O.C4H4N2/c1-6-3-2-4-7(5-6)11(9)8(10)12;1-2-5-4-6-3-1/h2-5H,1H3,(H2,10,12);1-4H.
What are the key properties of 1-bromo-1-(3-methylphenyl)urea;pyrimidine?
1-bromo-1-(3-methylphenyl)urea;pyrimidine has a molecular weight of 309.17 g/mol, XLogP of 2.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-1-(3-methylphenyl)urea;pyrimidine is sourced from PubChem (CID 174887918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).