C17H36O2 — CID 174888059
3,3,5-trimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]hexane (PubChem CID 174888059) has the molecular formula C17H36O2 and a molecular weight of 272.47 g/mol. Its IUPAC name is 3,3,5-trimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]hexane.
| Compound Name | 3,3,5-trimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]hexane |
|---|---|
| PubChem CID | 174888059 |
| Molecular Formula | C17H36O2 |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 272.27 |
| IUPAC Name | 3,3,5-trimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]hexane |
| SMILES | CC(C)CC(C)(C)CC(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C17H36O2/c1-13(2)11-17(9,10)12-14(18-15(3,4)5)19-16(6,7)8/h13-14H,11-12H2,1-10H3 |
| InChIKey | OZTGCSPIYNRBOL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|