About benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene
benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene (PubChem CID 174888195) has the molecular formula C21H30O2
and a molecular weight of 314.47 g/mol. Its IUPAC name is benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene.
Molecular Properties
| Compound Name | benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene |
| PubChem CID | 174888195 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene |
| SMILES | Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C15H24.C6H6O2/c1-11-8-12(14(2,3)4)10-13(9-11)15(5,6)7;7-5-1-2-6(8)4-3-5/h8-10H,1-7H3;1-4,7-8H |
| InChIKey | MCDBEGRVMBGEKL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene?
The IUPAC name of benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene (CID 174888195) is benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene.
What is the SMILES notation for benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene?
The canonical SMILES for benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene is Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1.Oc1ccc(O)cc1.
What is the InChIKey of benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene?
The InChIKey is MCDBEGRVMBGEKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24.C6H6O2/c1-11-8-12(14(2,3)4)10-13(9-11)15(5,6)7;7-5-1-2-6(8)4-3-5/h8-10H,1-7H3;1-4,7-8H.
What are the key properties of benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene?
benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene has a molecular weight of 314.47 g/mol, XLogP of 5.69, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;1,3-ditert-butyl-5-methylbenzene is sourced from PubChem (CID 174888195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).