About (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine
(1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine (PubChem CID 174888236) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine.
Molecular Properties
| Compound Name | (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine |
| PubChem CID | 174888236 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine |
| SMILES | CCC1(c2ccccc2)C=CC=CC1.CN |
| InChI | InChI=1S/C14H16.CH5N/c1-2-14(11-7-4-8-12-14)13-9-5-3-6-10-13;1-2/h3-11H,2,12H2,1H3;2H2,1H3 |
| InChIKey | OYDGYPLIMGONJA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine?
The IUPAC name of (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine (CID 174888236) is (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine.
What is the SMILES notation for (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine?
The canonical SMILES for (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine is CCC1(c2ccccc2)C=CC=CC1.CN.
What is the InChIKey of (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine?
The InChIKey is OYDGYPLIMGONJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16.CH5N/c1-2-14(11-7-4-8-12-14)13-9-5-3-6-10-13;1-2/h3-11H,2,12H2,1H3;2H2,1H3.
What are the key properties of (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine?
(1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine has a molecular weight of 215.34 g/mol, XLogP of 3.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclohexa-2,4-dien-1-yl)benzene;methanamine is sourced from PubChem (CID 174888236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).