About hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride
hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride (PubChem CID 174888282) has the molecular formula C4H10ClN3O2
and a molecular weight of 167.60 g/mol. Its IUPAC name is hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride.
Molecular Properties
| Compound Name | hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride |
| PubChem CID | 174888282 |
| Molecular Formula | C4H10ClN3O2 |
| Molecular Weight | 167.60 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride |
| SMILES | Cc1cc(N)no1.Cl.NO |
| InChI | InChI=1S/C4H6N2O.ClH.H3NO/c1-3-2-4(5)6-7-3;;1-2/h2H,1H3,(H2,5,6);1H;2H,1H2 |
| InChIKey | VTWWNRXSUUYSDV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.60 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride?
The IUPAC name of hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride (CID 174888282) is hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride.
What is the SMILES notation for hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride?
The canonical SMILES for hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride is Cc1cc(N)no1.Cl.NO.
What is the InChIKey of hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride?
The InChIKey is VTWWNRXSUUYSDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O.ClH.H3NO/c1-3-2-4(5)6-7-3;;1-2/h2H,1H3,(H2,5,6);1H;2H,1H2.
What are the key properties of hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride?
hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride has a molecular weight of 167.60 g/mol, XLogP of 0.32, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxylamine;5-methyl-1,2-oxazol-3-amine;hydrochloride is sourced from PubChem (CID 174888282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).