About 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one
1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one (PubChem CID 174888345) has the molecular formula C6H7Cl5O2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one.
Molecular Properties
| Compound Name | 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one |
| PubChem CID | 174888345 |
| Molecular Formula | C6H7Cl5O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 285.89 |
| IUPAC Name | 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one |
| SMILES | CC(=O)C(Cl)Cl.O=C(CCl)C(Cl)Cl |
| InChI | InChI=1S/C3H3Cl3O.C3H4Cl2O/c4-1-2(7)3(5)6;1-2(6)3(4)5/h3H,1H2;3H,1H3 |
| InChIKey | XHGUPUASPFISSC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one?
The IUPAC name of 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one (CID 174888345) is 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one.
What is the SMILES notation for 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one?
The canonical SMILES for 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one is CC(=O)C(Cl)Cl.O=C(CCl)C(Cl)Cl.
What is the InChIKey of 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one?
The InChIKey is XHGUPUASPFISSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3Cl3O.C3H4Cl2O/c4-1-2(7)3(5)6;1-2(6)3(4)5/h3H,1H2;3H,1H3.
What are the key properties of 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one?
1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one has a molecular weight of 288.39 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloropropan-2-one;1,1,3-trichloropropan-2-one is sourced from PubChem (CID 174888345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).