About 6-methoxyquinazolin-7-ol;hydrochloride
6-methoxyquinazolin-7-ol;hydrochloride (PubChem CID 174888473) has the molecular formula C9H9ClN2O2
and a molecular weight of 212.64 g/mol. Its IUPAC name is 6-methoxyquinazolin-7-ol;hydrochloride.
Molecular Properties
| Compound Name | 6-methoxyquinazolin-7-ol;hydrochloride |
| PubChem CID | 174888473 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 6-methoxyquinazolin-7-ol;hydrochloride |
| SMILES | COc1cc2cncnc2cc1O.Cl |
| InChI | InChI=1S/C9H8N2O2.ClH/c1-13-9-2-6-4-10-5-11-7(6)3-8(9)12;/h2-5,12H,1H3;1H |
| InChIKey | ODVCIKJGAHMIEX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxyquinazolin-7-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyquinazolin-7-ol;hydrochloride?
The IUPAC name of 6-methoxyquinazolin-7-ol;hydrochloride (CID 174888473) is 6-methoxyquinazolin-7-ol;hydrochloride.
What is the SMILES notation for 6-methoxyquinazolin-7-ol;hydrochloride?
The canonical SMILES for 6-methoxyquinazolin-7-ol;hydrochloride is COc1cc2cncnc2cc1O.Cl.
What is the InChIKey of 6-methoxyquinazolin-7-ol;hydrochloride?
The InChIKey is ODVCIKJGAHMIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2.ClH/c1-13-9-2-6-4-10-5-11-7(6)3-8(9)12;/h2-5,12H,1H3;1H.
What are the key properties of 6-methoxyquinazolin-7-ol;hydrochloride?
6-methoxyquinazolin-7-ol;hydrochloride has a molecular weight of 212.64 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyquinazolin-7-ol;hydrochloride is sourced from PubChem (CID 174888473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).