About 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine
3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine (PubChem CID 174888515) has the molecular formula C17H15FN2O2
and a molecular weight of 298.32 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine |
| PubChem CID | 174888515 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine |
| SMILES | CC1=CN(OCc2ccccc2)C(c2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C17H15FN2O2/c1-13-11-20(21-12-14-5-3-2-4-6-14)17(19-22-13)15-7-9-16(18)10-8-15/h2-11H,12H2,1H3 |
| InChIKey | GNYVSJIHYGCSBE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine?
The IUPAC name of 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine (CID 174888515) is 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine.
What is the SMILES notation for 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine?
The canonical SMILES for 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine is CC1=CN(OCc2ccccc2)C(c2ccc(F)cc2)=NO1.
What is the InChIKey of 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine?
The InChIKey is GNYVSJIHYGCSBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FN2O2/c1-13-11-20(21-12-14-5-3-2-4-6-14)17(19-22-13)15-7-9-16(18)10-8-15/h2-11H,12H2,1H3.
What are the key properties of 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine?
3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine has a molecular weight of 298.32 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-6-methyl-4-phenylmethoxy-1,2,4-oxadiazine is sourced from PubChem (CID 174888515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).