About acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol
acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol (PubChem CID 174888616) has the molecular formula C15H21NO3S
and a molecular weight of 295.40 g/mol. Its IUPAC name is acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol.
Molecular Properties
| Compound Name | acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol |
| PubChem CID | 174888616 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol |
| SMILES | CC(=O)O.CCc1ccccc1.CCc1ncc(O)s1 |
| InChI | InChI=1S/C8H10.C5H7NOS.C2H4O2/c1-2-8-6-4-3-5-7-8;1-2-4-6-3-5(7)8-4;1-2(3)4/h3-7H,2H2,1H3;3,7H,2H2,1H3;1H3,(H,3,4) |
| InChIKey | AKYDTBYLPFJQKO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol?
The IUPAC name of acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol (CID 174888616) is acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol.
What is the SMILES notation for acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol?
The canonical SMILES for acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol is CC(=O)O.CCc1ccccc1.CCc1ncc(O)s1.
What is the InChIKey of acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol?
The InChIKey is AKYDTBYLPFJQKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C5H7NOS.C2H4O2/c1-2-8-6-4-3-5-7-8;1-2-4-6-3-5(7)8-4;1-2(3)4/h3-7H,2H2,1H3;3,7H,2H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol?
acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol has a molecular weight of 295.40 g/mol, XLogP of 3.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethylbenzene;2-ethyl-1,3-thiazol-5-ol is sourced from PubChem (CID 174888616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).