About ethanethioamide;λ2-plumbane
ethanethioamide;λ2-plumbane (PubChem CID 174888754) has the molecular formula C2H7NPbS
and a molecular weight of 284.35 g/mol. Its IUPAC name is ethanethioamide;λ2-plumbane.
Molecular Properties
| Compound Name | ethanethioamide;λ2-plumbane |
| PubChem CID | 174888754 |
| Molecular Formula | C2H7NPbS |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | ethanethioamide;λ2-plumbane |
| SMILES | CC(N)=S.[PbH2] |
| InChI | InChI=1S/C2H5NS.Pb.2H/c1-2(3)4;;;/h1H3,(H2,3,4);;; |
| InChIKey | LEHRDIDWGPBXDG-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethanethioamide;λ2-plumbane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanethioamide;λ2-plumbane?
The IUPAC name of ethanethioamide;λ2-plumbane (CID 174888754) is ethanethioamide;λ2-plumbane.
What is the SMILES notation for ethanethioamide;λ2-plumbane?
The canonical SMILES for ethanethioamide;λ2-plumbane is CC(N)=S.[PbH2].
What is the InChIKey of ethanethioamide;λ2-plumbane?
The InChIKey is LEHRDIDWGPBXDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NS.Pb.2H/c1-2(3)4;;;/h1H3,(H2,3,4);;;.
What are the key properties of ethanethioamide;λ2-plumbane?
ethanethioamide;λ2-plumbane has a molecular weight of 284.35 g/mol, XLogP of -0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanethioamide;λ2-plumbane is sourced from PubChem (CID 174888754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).