About bicyclo[4.1.0]hepta-1,3,5-triene;furan
bicyclo[4.1.0]hepta-1,3,5-triene;furan (PubChem CID 174888832) has the molecular formula C11H10O
and a molecular weight of 158.20 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;furan.
Molecular Properties
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;furan |
| PubChem CID | 174888832 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;furan |
| SMILES | c1ccc2c(c1)C2.c1ccoc1 |
| InChI | InChI=1S/C7H6.C4H4O/c1-2-4-7-5-6(7)3-1;1-2-4-5-3-1/h1-4H,5H2;1-4H |
| InChIKey | MYMPQXBTXFWBTN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[4.1.0]hepta-1,3,5-triene;furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;furan?
The IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;furan (CID 174888832) is bicyclo[4.1.0]hepta-1,3,5-triene;furan.
What is the SMILES notation for bicyclo[4.1.0]hepta-1,3,5-triene;furan?
The canonical SMILES for bicyclo[4.1.0]hepta-1,3,5-triene;furan is c1ccc2c(c1)C2.c1ccoc1.
What is the InChIKey of bicyclo[4.1.0]hepta-1,3,5-triene;furan?
The InChIKey is MYMPQXBTXFWBTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6.C4H4O/c1-2-4-7-5-6(7)3-1;1-2-4-5-3-1/h1-4H,5H2;1-4H.
What are the key properties of bicyclo[4.1.0]hepta-1,3,5-triene;furan?
bicyclo[4.1.0]hepta-1,3,5-triene;furan has a molecular weight of 158.20 g/mol, XLogP of 2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.1.0]hepta-1,3,5-triene;furan is sourced from PubChem (CID 174888832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).