C25H47N — CID 174888934
1,2,4,6-tetramethylcyclooctane;1-(2,2,4,4-tetramethylpentan-3-yl)pyrrole (PubChem CID 174888934) has the molecular formula C25H47N and a molecular weight of 361.66 g/mol. Its IUPAC name is 1,2,4,6-tetramethylcyclooctane;1-(2,2,4,4-tetramethylpentan-3-yl)pyrrole.
| Compound Name | 1,2,4,6-tetramethylcyclooctane;1-(2,2,4,4-tetramethylpentan-3-yl)pyrrole |
|---|---|
| PubChem CID | 174888934 |
| Molecular Formula | C25H47N |
| Molecular Weight | 361.66 g/mol |
| Exact Mass | 361.37 |
| IUPAC Name | 1,2,4,6-tetramethylcyclooctane;1-(2,2,4,4-tetramethylpentan-3-yl)pyrrole |
| SMILES | CC(C)(C)C(n1cccc1)C(C)(C)C.CC1CCC(C)C(C)CC(C)C1 |
| InChI | InChI=1S/C13H23N.C12H24/c1-12(2,3)11(13(4,5)6)14-9-7-8-10-14;1-9-5-6-11(3)12(4)8-10(2)7-9/h7-11H,1-6H3;9-12H,5-8H2,1-4H3 |
| InChIKey | GSIBVJUSLDIXJI-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.66 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |