About 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile
2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile (PubChem CID 174889042) has the molecular formula C5H9N3S4
and a molecular weight of 239.42 g/mol. Its IUPAC name is 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile.
Molecular Properties
| Compound Name | 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile |
| PubChem CID | 174889042 |
| Molecular Formula | C5H9N3S4 |
| Molecular Weight | 239.42 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile |
| SMILES | C#N.S=C(S)NCCNC(=S)S |
| InChI | InChI=1S/C4H8N2S4.CHN/c7-3(8)5-1-2-6-4(9)10;1-2/h1-2H2,(H2,5,7,8)(H2,6,9,10);1H |
| InChIKey | WAIBOZPIWOZEHG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile?
The IUPAC name of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile (CID 174889042) is 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile.
What is the SMILES notation for 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile?
The canonical SMILES for 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile is C#N.S=C(S)NCCNC(=S)S.
What is the InChIKey of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile?
The InChIKey is WAIBOZPIWOZEHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2S4.CHN/c7-3(8)5-1-2-6-4(9)10;1-2/h1-2H2,(H2,5,7,8)(H2,6,9,10);1H.
What are the key properties of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile?
2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile has a molecular weight of 239.42 g/mol, XLogP of 0.73, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dithiocarboxyamino)ethylcarbamodithioic acid;formonitrile is sourced from PubChem (CID 174889042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).