About (4,4-difluorocyclohexyl) N-tert-butylcarbamate
(4,4-difluorocyclohexyl) N-tert-butylcarbamate (PubChem CID 174889069) has the molecular formula C11H19F2NO2
and a molecular weight of 235.27 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl) N-tert-butylcarbamate.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl) N-tert-butylcarbamate |
| PubChem CID | 174889069 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (4,4-difluorocyclohexyl) N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H19F2NO2/c1-10(2,3)14-9(15)16-8-4-6-11(12,13)7-5-8/h8H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | XBWRXPSPHPVNPR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,4-difluorocyclohexyl) N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl) N-tert-butylcarbamate?
The IUPAC name of (4,4-difluorocyclohexyl) N-tert-butylcarbamate (CID 174889069) is (4,4-difluorocyclohexyl) N-tert-butylcarbamate.
What is the SMILES notation for (4,4-difluorocyclohexyl) N-tert-butylcarbamate?
The canonical SMILES for (4,4-difluorocyclohexyl) N-tert-butylcarbamate is CC(C)(C)NC(=O)OC1CCC(F)(F)CC1.
What is the InChIKey of (4,4-difluorocyclohexyl) N-tert-butylcarbamate?
The InChIKey is XBWRXPSPHPVNPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO2/c1-10(2,3)14-9(15)16-8-4-6-11(12,13)7-5-8/h8H,4-7H2,1-3H3,(H,14,15).
What are the key properties of (4,4-difluorocyclohexyl) N-tert-butylcarbamate?
(4,4-difluorocyclohexyl) N-tert-butylcarbamate has a molecular weight of 235.27 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl) N-tert-butylcarbamate is sourced from PubChem (CID 174889069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).