About 5-nitro-1H-imidazole;propan-1-ol
5-nitro-1H-imidazole;propan-1-ol (PubChem CID 174889117) has the molecular formula C6H11N3O3
and a molecular weight of 173.17 g/mol. Its IUPAC name is 5-nitro-1H-imidazole;propan-1-ol.
Molecular Properties
| Compound Name | 5-nitro-1H-imidazole;propan-1-ol |
| PubChem CID | 174889117 |
| Molecular Formula | C6H11N3O3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5-nitro-1H-imidazole;propan-1-ol |
| SMILES | CCCO.O=[N+]([O-])c1cnc[nH]1 |
| InChI | InChI=1S/C3H3N3O2.C3H8O/c7-6(8)3-1-4-2-5-3;1-2-3-4/h1-2H,(H,4,5);4H,2-3H2,1H3 |
| InChIKey | HUMZPDQTTZUJOE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1H-imidazole;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1H-imidazole;propan-1-ol?
The IUPAC name of 5-nitro-1H-imidazole;propan-1-ol (CID 174889117) is 5-nitro-1H-imidazole;propan-1-ol.
What is the SMILES notation for 5-nitro-1H-imidazole;propan-1-ol?
The canonical SMILES for 5-nitro-1H-imidazole;propan-1-ol is CCCO.O=[N+]([O-])c1cnc[nH]1.
What is the InChIKey of 5-nitro-1H-imidazole;propan-1-ol?
The InChIKey is HUMZPDQTTZUJOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O2.C3H8O/c7-6(8)3-1-4-2-5-3;1-2-3-4/h1-2H,(H,4,5);4H,2-3H2,1H3.
What are the key properties of 5-nitro-1H-imidazole;propan-1-ol?
5-nitro-1H-imidazole;propan-1-ol has a molecular weight of 173.17 g/mol, XLogP of 0.71, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1H-imidazole;propan-1-ol is sourced from PubChem (CID 174889117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).