About 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene
3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene (PubChem CID 174889840) has the molecular formula C26H19NO6
and a molecular weight of 441.44 g/mol. Its IUPAC name is 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene.
Molecular Properties
| Compound Name | 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene |
| PubChem CID | 174889840 |
| Molecular Formula | C26H19NO6 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene |
| SMILES | O=C1OC(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccccc21.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C20H14O4.C6H5NO2/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20;8-7(9)6-4-2-1-3-5-6/h1-12,21-22H;1-5H |
| InChIKey | HQOWOQMXVFMBLY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene?
The IUPAC name of 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene (CID 174889840) is 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene.
What is the SMILES notation for 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene?
The canonical SMILES for 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene is O=C1OC(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccccc21.O=[N+]([O-])c1ccccc1.
What is the InChIKey of 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene?
The InChIKey is HQOWOQMXVFMBLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O4.C6H5NO2/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20;8-7(9)6-4-2-1-3-5-6/h1-12,21-22H;1-5H.
What are the key properties of 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene?
3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene has a molecular weight of 441.44 g/mol, XLogP of 5.15, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;nitrobenzene is sourced from PubChem (CID 174889840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).